Write the balanced chemical equation for the following and identify the type of
reaction in each case (As1)

a) Calcium hydroxide (aq) + Nitric acid (aq) → Water (l) + calcium nitrate (aq)

b) Magnesium(s) + Iodine (g) → Magnesium iodide(s)

c) Magnesium(s) + hydrochloric acid (aq) → Magnesium chloride (aq) + Hydrogen (g)

d) Zinc(s) + calcium chloride (aq) + → Zinc chloride (aq) + Ca(s)

1

Answers

2016-03-16T22:12:29+05:30
Ca(OH)2+2HNO3=2H20+Ca(NO3)2
2Mg+I2 =2MgI
Mg+2HCl=MgCl2+H2
Zn+CaCl2=ZnCl2+Ca

1.double displacement
2.chemical combination
3.displacement
4.displacement
1 5 1